C19H16N4O4S2 — CID 135884872
(2E,5S)-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one (PubChem CID 135884872) has the molecular formula C19H16N4O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is (2E,5S)-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135884872 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (2E,5S)-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-5-phenacyl-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C2/S[C@@H](CC(=O)c3ccccc3)C(=O)N2Cc2ccco2)CS1 |
| InChI | InChI=1S/C19H16N4O4S2/c24-14(12-5-2-1-3-6-12)9-15-17(25)23(10-13-7-4-8-27-13)18(29-15)22-21-16-11-28-19(26)20-16/h1-8,15H,9-11H2,(H,20,21,26)/b22-18+/t15-/m0/s1 |
| InChIKey | DYIIUZNCITVYSY-CYNURGJPSA-N |
| XLogP | 3.12 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|