C21H20N4O4S2 — CID 135899430
(2Z,5S)-5-[2-(2,5-dimethylphenyl)-2-oxoethyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135899430) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (2Z,5S)-5-[2-(2,5-dimethylphenyl)-2-oxoethyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-5-[2-(2,5-dimethylphenyl)-2-oxoethyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135899430 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (2Z,5S)-5-[2-(2,5-dimethylphenyl)-2-oxoethyl]-3-(furan-2-ylmethyl)-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C)c(C(=O)C[C@@H]2S/C(=N\N=C3/CSC(=O)N3)N(Cc3ccco3)C2=O)c1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-12-5-6-13(2)15(8-12)16(26)9-17-19(27)25(10-14-4-3-7-29-14)20(31-17)24-23-18-11-30-21(28)22-18/h3-8,17H,9-11H2,1-2H3,(H,22,23,28)/b24-20-/t17-/m0/s1 |
| InChIKey | XTBNKKVBFBZNLK-DJUDNFEDSA-N |
| XLogP | 3.74 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|