C26H27N3O3S — CID 46802746
2-[2-(3,4-dimethylphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide (PubChem CID 46802746) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-(3,4-dimethylphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 46802746 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide |
| SMILES | COCCN1C(=O)C(CC(=O)Nc2ccc3ccccc3c2)S/C1=N\c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H27N3O3S/c1-17-8-10-21(14-18(17)2)28-26-29(12-13-32-3)25(31)23(33-26)16-24(30)27-22-11-9-19-6-4-5-7-20(19)15-22/h4-11,14-15,23H,12-13,16H2,1-3H3,(H,27,30)/b28-26- |
| InChIKey | RVWKNTIPSRVXGR-SGEDCAFJSA-N |
| XLogP | 5.06 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|