C23H27N3O4S — CID 42990706
2-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide (PubChem CID 42990706) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 42990706 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1ccc(/N=C2\SC(CC(=O)Nc3ccc(C)cc3)C(=O)N2CCOC)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-4-30-19-11-9-18(10-12-19)25-23-26(13-14-29-3)22(28)20(31-23)15-21(27)24-17-7-5-16(2)6-8-17/h5-12,20H,4,13-15H2,1-3H3,(H,24,27)/b25-23- |
| InChIKey | WCUFDWJZKZSYEA-BZZOAKBMSA-N |
| XLogP | 4.00 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|