C28H24N4O2S — CID 42993815
2-[2-(4-methylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide (PubChem CID 42993815) has the molecular formula C28H24N4O2S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-(4-methylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 42993815 |
| Molecular Formula | C28H24N4O2S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[2-(4-methylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-naphthalen-2-ylacetamide |
| SMILES | Cc1ccc(/N=C2\SC(CC(=O)Nc3ccc4ccccc4c3)C(=O)N2Cc2ccccn2)cc1 |
| InChI | InChI=1S/C28H24N4O2S/c1-19-9-12-22(13-10-19)31-28-32(18-24-8-4-5-15-29-24)27(34)25(35-28)17-26(33)30-23-14-11-20-6-2-3-7-21(20)16-23/h2-16,25H,17-18H2,1H3,(H,30,33)/b31-28- |
| InChIKey | YFSHOECEVPPNJB-PNOGMODKSA-N |
| XLogP | 5.70 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|