C26H26N4O2S — CID 4072021
N-benzyl-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 4072021) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-benzyl-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-benzyl-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 4072021 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-benzyl-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(/N=C2\SC(CC(=O)NCc3ccccc3)C(=O)N2Cc2ccccn2)c(C)c1 |
| InChI | InChI=1S/C26H26N4O2S/c1-18-11-12-22(19(2)14-18)29-26-30(17-21-10-6-7-13-27-21)25(32)23(33-26)15-24(31)28-16-20-8-4-3-5-9-20/h3-14,23H,15-17H2,1-2H3,(H,28,31)/b29-26- |
| InChIKey | KAMBBNKKWOEEOD-WCTVFOPTSA-N |
| XLogP | 4.54 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|