C27H21ClN4O2S — CID 2401688
N-(2-chlorophenyl)-2-[(5R)-2-naphthalen-1-ylimino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 2401688) has the molecular formula C27H21ClN4O2S and a molecular weight of 501.01 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(5R)-2-naphthalen-1-ylimino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(5R)-2-naphthalen-1-ylimino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 2401688 |
| Molecular Formula | C27H21ClN4O2S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(5R)-2-naphthalen-1-ylimino-4-oxo-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\c2cccc3ccccc23)N(Cc2ccccn2)C1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C27H21ClN4O2S/c28-21-12-3-4-13-23(21)30-25(33)16-24-26(34)32(17-19-10-5-6-15-29-19)27(35-24)31-22-14-7-9-18-8-1-2-11-20(18)22/h1-15,24H,16-17H2,(H,30,33)/b31-27-/t24-/m1/s1 |
| InChIKey | ULLDMASPPBEZTH-BWUCGBNQSA-N |
| XLogP | 6.05 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|