C24H23N5O2S — CID 21235061
N-benzyl-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 21235061) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-benzyl-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-benzyl-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 21235061 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-benzyl-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1S/C(=N\Cc2cccnc2)N(Cc2cccnc2)C1=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H23N5O2S/c30-22(27-15-18-6-2-1-3-7-18)12-21-23(31)29(17-20-9-5-11-26-14-20)24(32-21)28-16-19-8-4-10-25-13-19/h1-11,13-14,21H,12,15-17H2,(H,27,30)/b28-24- |
| InChIKey | HSQQJHKXCBODDM-COOPMVRXSA-N |
| XLogP | 3.18 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|