C19H20N4O3 — CID 71829380
2-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 71829380) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 71829380 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[(4S)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)N(CCc2ccccc2)C1=O)NCc1cccnc1 |
| InChI | InChI=1S/C19H20N4O3/c24-17(21-13-15-7-4-9-20-12-15)11-16-18(25)23(19(26)22-16)10-8-14-5-2-1-3-6-14/h1-7,9,12,16H,8,10-11,13H2,(H,21,24)(H,22,26)/t16-/m0/s1 |
| InChIKey | QTIPISAZICJLPK-INIZCTEOSA-N |
| XLogP | 1.25 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|