C29H25N5O5S — CID 3686521
N-(3-acetylphenyl)-2-[3-[2-(1H-indol-3-yl)ethyl]-2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 3686521) has the molecular formula C29H25N5O5S and a molecular weight of 555.62 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[3-[2-(1H-indol-3-yl)ethyl]-2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[3-[2-(1H-indol-3-yl)ethyl]-2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3686521 |
| Molecular Formula | C29H25N5O5S |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | N-(3-acetylphenyl)-2-[3-[2-(1H-indol-3-yl)ethyl]-2-(4-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CC2S/C(=N\c3ccc([N+](=O)[O-])cc3)N(CCc3c[nH]c4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C29H25N5O5S/c1-18(35)19-5-4-6-22(15-19)31-27(36)16-26-28(37)33(14-13-20-17-30-25-8-3-2-7-24(20)25)29(40-26)32-21-9-11-23(12-10-21)34(38)39/h2-12,15,17,26,30H,13-14,16H2,1H3,(H,31,36)/b32-29- |
| InChIKey | SGBKPPVTXUKHRJ-OVXWJCGASA-N |
| XLogP | 5.48 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|