C22H20FN3O3S — CID 98202119
methyl 2-[(5S)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate (PubChem CID 98202119) has the molecular formula C22H20FN3O3S and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 2-[(5S)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate.
| Compound Name | methyl 2-[(5S)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 98202119 |
| Molecular Formula | C22H20FN3O3S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 2-[(5S)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate |
| SMILES | COC(=O)C[C@@H]1S/C(=N\c2ccccc2)N(CCc2c[nH]c3cc(F)ccc23)C1=O |
| InChI | InChI=1S/C22H20FN3O3S/c1-29-20(27)12-19-21(28)26(22(30-19)25-16-5-3-2-4-6-16)10-9-14-13-24-18-11-15(23)7-8-17(14)18/h2-8,11,13,19,24H,9-10,12H2,1H3/b25-22-/t19-/m0/s1 |
| InChIKey | NQFYLORMCOORIQ-NWIBBQCFSA-N |
| XLogP | 4.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|