C24H19ClN5O2S+ — CID 42581707
2-(1,3-benzothiazol-3-ium-2-yl)-5-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 42581707) has the molecular formula C24H19ClN5O2S+ and a molecular weight of 476.97 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-3-ium-2-yl)-5-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2-(1,3-benzothiazol-3-ium-2-yl)-5-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 42581707 |
| Molecular Formula | C24H19ClN5O2S+ |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-(1,3-benzothiazol-3-ium-2-yl)-5-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | Cc1c2c(=O)n(-c3[nH+]c4ccccc4s3)[nH]c2cc(=O)n1CCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H18ClN5O2S/c1-13-22-19(28-30(23(22)32)24-27-18-4-2-3-5-20(18)33-24)11-21(31)29(13)9-8-14-12-26-17-7-6-15(25)10-16(14)17/h2-7,10-12,26,28H,8-9H2,1H3/p+1 |
| InChIKey | JISGRJRKXWMFGV-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|