C30H24FN3O2S — CID 23932673
3-(3,3-diphenylpropyl)-N-(2-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23932673) has the molecular formula C30H24FN3O2S and a molecular weight of 509.61 g/mol. Its IUPAC name is 3-(3,3-diphenylpropyl)-N-(2-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(3,3-diphenylpropyl)-N-(2-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23932673 |
| Molecular Formula | C30H24FN3O2S |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 3-(3,3-diphenylpropyl)-N-(2-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(-c2cs/c(=N\c3ccccc3F)n2CCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24FN3O2S/c31-27-13-7-8-14-28(27)32-30-33(29(21-37-30)24-15-17-25(18-16-24)34(35)36)20-19-26(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-18,21,26H,19-20H2/b32-30- |
| InChIKey | XRAHPTQSVFUWPT-GCUVURNUSA-N |
| XLogP | 7.72 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|