C36H58N6O13 — CID 20801395
2-[6-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate (PubChem CID 20801395) has the molecular formula C36H58N6O13 and a molecular weight of 782.89 g/mol. Its IUPAC name is 2-[6-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[6-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 20801395 |
| Molecular Formula | C36H58N6O13 |
| Molecular Weight | 782.89 g/mol |
| Exact Mass | 782.41 |
| IUPAC Name | 2-[6-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCCCCCn1c(=O)n(CCCCCCNC(=O)OCC)c(=O)n(CCCCCCNC(=O)OCCOC(=O)C=C)c1=O |
| InChI | InChI=1S/C36H58N6O13/c1-4-29(43)52-25-27-54-32(46)38-20-14-8-11-17-23-41-34(48)40(22-16-10-7-13-19-37-31(45)51-6-3)35(49)42(36(41)50)24-18-12-9-15-21-39-33(47)55-28-26-53-30(44)5-2/h4-5H,1-2,6-28H2,3H3,(H,37,45)(H,38,46)(H,39,47) |
| InChIKey | WERABBQRJNGOGP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 233.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|