C38H64N6O12 — CID 161339598
2-[[6-[3-[6-(ethoxycarbonylamino)hexyl]-5-[6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylamino]methoxy]ethyl 2-methylprop-2-enoate (PubChem CID 161339598) has the molecular formula C38H64N6O12 and a molecular weight of 796.96 g/mol. Its IUPAC name is 2-[[6-[3-[6-(ethoxycarbonylamino)hexyl]-5-[6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylamino]methoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[6-[3-[6-(ethoxycarbonylamino)hexyl]-5-[6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylamino]methoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161339598 |
| Molecular Formula | C38H64N6O12 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.46 |
| IUPAC Name | 2-[[6-[3-[6-(ethoxycarbonylamino)hexyl]-5-[6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylamino]methoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCNCCCCCCn1c(=O)n(CCCCCCNC(=O)OCC)c(=O)n(CCCCCCNC(=O)OCCOC(=O)C(=C)C)c1=O |
| InChI | InChI=1S/C38H64N6O12/c1-6-53-34(47)40-20-14-8-11-17-23-43-36(49)42(22-16-10-7-13-19-39-29-52-25-26-54-32(45)30(2)3)37(50)44(38(43)51)24-18-12-9-15-21-41-35(48)56-28-27-55-33(46)31(4)5/h39H,2,4,6-29H2,1,3,5H3,(H,40,47)(H,41,48) |
| InChIKey | VMMJZBBGYKQTQA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 216.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|