C24H42N6O12 — CID 59245405
2-[3,5-bis[2-(2-ethoxyethylcarbamoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-(2-ethoxyethyl)carbamate (PubChem CID 59245405) has the molecular formula C24H42N6O12 and a molecular weight of 606.63 g/mol. Its IUPAC name is 2-[3,5-bis[2-(2-ethoxyethylcarbamoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-(2-ethoxyethyl)carbamate.
| Compound Name | 2-[3,5-bis[2-(2-ethoxyethylcarbamoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-(2-ethoxyethyl)carbamate |
|---|---|
| PubChem CID | 59245405 |
| Molecular Formula | C24H42N6O12 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 2-[3,5-bis[2-(2-ethoxyethylcarbamoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-(2-ethoxyethyl)carbamate |
| SMILES | CCOCCNC(=O)OCCn1c(=O)n(CCOC(=O)NCCOCC)c(=O)n(CCOC(=O)NCCOCC)c1=O |
| InChI | InChI=1S/C24H42N6O12/c1-4-37-13-7-25-19(31)40-16-10-28-22(34)29(11-17-41-20(32)26-8-14-38-5-2)24(36)30(23(28)35)12-18-42-21(33)27-9-15-39-6-3/h4-18H2,1-3H3,(H,25,31)(H,26,32)(H,27,33) |
| InChIKey | VFVIAAQZBGHZEO-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 208.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|