C30H43N7O12 — CID 159484144
2-[3-[2-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate;methane (PubChem CID 159484144) has the molecular formula C30H43N7O12 and a molecular weight of 693.71 g/mol. Its IUPAC name is 2-[3-[2-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate;methane.
| Compound Name | 2-[3-[2-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate;methane |
|---|---|
| PubChem CID | 159484144 |
| Molecular Formula | C30H43N7O12 |
| Molecular Weight | 693.71 g/mol |
| Exact Mass | 693.30 |
| IUPAC Name | 2-[3-[2-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl N-[5-(2,5-dioxopyrrol-1-yl)pentyl]carbamate;methane |
| SMILES | C.O=C(NCCCCCN1C(=O)C=CC1=O)OCCn1c(=O)n(CCO)c(=O)n(CCOC(=O)NCCCCCN2C(=O)C=CC2=O)c1=O |
| InChI | InChI=1S/C29H39N7O12.CH4/c37-18-15-34-27(44)35(16-19-47-25(42)30-11-3-1-5-13-32-21(38)7-8-22(32)39)29(46)36(28(34)45)17-20-48-26(43)31-12-4-2-6-14-33-23(40)9-10-24(33)41;/h7-10,37H,1-6,11-20H2,(H,30,42)(H,31,43);1H4 |
| InChIKey | LXJHLJNFIOBNKC-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 237.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.71 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|