C29H37N5O12 — CID 58986530
2-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 58986530) has the molecular formula C29H37N5O12 and a molecular weight of 647.64 g/mol. Its IUPAC name is 2-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | 2-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 58986530 |
| Molecular Formula | C29H37N5O12 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | 2-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-5-(2-hydroxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OCCn1c(=O)n(CCO)c(=O)n(CCOC(=O)CCCCCN2C(=O)C=CC2=O)c1=O |
| InChI | InChI=1S/C29H37N5O12/c35-18-15-32-27(42)33(16-19-45-25(40)7-3-1-5-13-30-21(36)9-10-22(30)37)29(44)34(28(32)43)17-20-46-26(41)8-4-2-6-14-31-23(38)11-12-24(31)39/h9-12,35H,1-8,13-20H2 |
| InChIKey | HIKUFFIPDPTTNQ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 213.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|