C26H40N6O13 — CID 131972202
5-methoxypentyl 3-[3-[3-[2-[3-(2-hydroxyethyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate (PubChem CID 131972202) has the molecular formula C26H40N6O13 and a molecular weight of 644.64 g/mol. Its IUPAC name is 5-methoxypentyl 3-[3-[3-[2-[3-(2-hydroxyethyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate.
| Compound Name | 5-methoxypentyl 3-[3-[3-[2-[3-(2-hydroxyethyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 131972202 |
| Molecular Formula | C26H40N6O13 |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | 5-methoxypentyl 3-[3-[3-[2-[3-(2-hydroxyethyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
| SMILES | COCCCCCOC(=O)CCn1c(=O)n(C)c(=O)n(CCC(=O)OCCn2c(=O)n(CCO)c(=O)n(CCOC)c2=O)c1=O |
| InChI | InChI=1S/C26H40N6O13/c1-27-21(36)28(9-7-19(34)44-16-6-4-5-15-42-2)23(38)29(22(27)37)10-8-20(35)45-18-13-32-25(40)30(11-14-33)24(39)31(26(32)41)12-17-43-3/h33H,4-18H2,1-3H3 |
| InChIKey | PGLIYABTUNROOC-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 223.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|