C16H25N3O11 — CID 59503056
2,3-dihydroxypropyl 3-[3-[3-(2,3-dihydroxypropoxy)-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate (PubChem CID 59503056) has the molecular formula C16H25N3O11 and a molecular weight of 435.39 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-[3-[3-(2,3-dihydroxypropoxy)-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate.
| Compound Name | 2,3-dihydroxypropyl 3-[3-[3-(2,3-dihydroxypropoxy)-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 59503056 |
| Molecular Formula | C16H25N3O11 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2,3-dihydroxypropyl 3-[3-[3-(2,3-dihydroxypropoxy)-3-oxopropyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
| SMILES | Cn1c(=O)n(CCC(=O)OCC(O)CO)c(=O)n(CCC(=O)OCC(O)CO)c1=O |
| InChI | InChI=1S/C16H25N3O11/c1-17-14(26)18(4-2-12(24)29-8-10(22)6-20)16(28)19(15(17)27)5-3-13(25)30-9-11(23)7-21/h10-11,20-23H,2-9H2,1H3 |
| InChIKey | UGWSCLNHLXIMTF-UHFFFAOYSA-N |
| XLogP | -4.72 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |