C39H52N6O14 — CID 123671360
2-[3,5-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2-oxopyrrolidin-1-yl)hexanoate (PubChem CID 123671360) has the molecular formula C39H52N6O14 and a molecular weight of 828.87 g/mol. Its IUPAC name is 2-[3,5-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2-oxopyrrolidin-1-yl)hexanoate.
| Compound Name | 2-[3,5-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2-oxopyrrolidin-1-yl)hexanoate |
|---|---|
| PubChem CID | 123671360 |
| Molecular Formula | C39H52N6O14 |
| Molecular Weight | 828.87 g/mol |
| Exact Mass | 828.35 |
| IUPAC Name | 2-[3,5-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 6-(2-oxopyrrolidin-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1CCCC1=O)OCCn1c(=O)n(CCOC(=O)CCCCCN2C(=O)C=CC2=O)c(=O)n(CCOC(=O)CCCCCN2C(=O)C=CC2=O)c1=O |
| InChI | InChI=1S/C39H52N6O14/c46-29-11-10-20-40(29)19-7-1-4-12-34(51)57-26-23-43-37(54)44(24-27-58-35(52)13-5-2-8-21-41-30(47)15-16-31(41)48)39(56)45(38(43)55)25-28-59-36(53)14-6-3-9-22-42-32(49)17-18-33(42)50/h15-18H,1-14,19-28H2 |
| InChIKey | SQFAMNJKYJUVNC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 239.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.87 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|