C37H59N5O13 — CID 58291285
2-prop-2-enoyloxyethyl 8-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate (PubChem CID 58291285) has the molecular formula C37H59N5O13 and a molecular weight of 781.90 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 8-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 8-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate |
|---|---|
| PubChem CID | 58291285 |
| Molecular Formula | C37H59N5O13 |
| Molecular Weight | 781.90 g/mol |
| Exact Mass | 781.41 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 8-[3-[6-(ethoxycarbonylamino)hexyl]-2,4,6-trioxo-5-[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCCCn1c(=O)n(CCCCCCNC(=O)OCC)c(=O)n(CCCCCCNC(=O)OCCOC(=O)C=C)c1=O |
| InChI | InChI=1S/C37H59N5O13/c1-4-30(43)52-26-27-54-32(45)20-14-8-7-11-17-23-40-35(48)41(24-18-12-9-15-21-38-33(46)51-6-3)37(50)42(36(40)49)25-19-13-10-16-22-39-34(47)55-29-28-53-31(44)5-2/h4-5H,1-2,6-29H2,3H3,(H,38,46)(H,39,47) |
| InChIKey | REZWWOZWZBYKQL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 221.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|