C42H63N3O14 — CID 158088040
2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-(8-oxo-10-prop-2-enoyloxydecyl)-5-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-1,3,5-triazinan-1-yl]octanoate (PubChem CID 158088040) has the molecular formula C42H63N3O14 and a molecular weight of 833.97 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-(8-oxo-10-prop-2-enoyloxydecyl)-5-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-1,3,5-triazinan-1-yl]octanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-(8-oxo-10-prop-2-enoyloxydecyl)-5-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-1,3,5-triazinan-1-yl]octanoate |
|---|---|
| PubChem CID | 158088040 |
| Molecular Formula | C42H63N3O14 |
| Molecular Weight | 833.97 g/mol |
| Exact Mass | 833.43 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-(8-oxo-10-prop-2-enoyloxydecyl)-5-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-1,3,5-triazinan-1-yl]octanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCCCn1c(=O)n(CCCCCCCC(=O)CCOC(=O)C=C)c(=O)n(CCCCCCCC(=O)OCCOC(=O)C=C)c1=O |
| InChI | InChI=1S/C42H63N3O14/c1-4-35(47)55-29-25-34(46)22-16-10-7-13-19-26-43-40(52)44(27-20-14-8-11-17-23-38(50)58-32-30-56-36(48)5-2)42(54)45(41(43)53)28-21-15-9-12-18-24-39(51)59-33-31-57-37(49)6-3/h4-6H,1-3,7-33H2 |
| InChIKey | IHNCVNOYAHKHPP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 214.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.97 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|