C41H62N4O15 — CID 58291281
2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-5-[6-(1-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate (PubChem CID 58291281) has the molecular formula C41H62N4O15 and a molecular weight of 850.96 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-5-[6-(1-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-5-[6-(1-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate |
|---|---|
| PubChem CID | 58291281 |
| Molecular Formula | C41H62N4O15 |
| Molecular Weight | 850.96 g/mol |
| Exact Mass | 850.42 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 8-[2,4,6-trioxo-3-[8-oxo-8-(2-prop-2-enoyloxyethoxy)octyl]-5-[6-(1-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-triazinan-1-yl]octanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCCCn1c(=O)n(CCCCCCCC(=O)OCCOC(=O)C=C)c(=O)n(CCCCCCNC(=O)OC(C)OC(=O)C=C)c1=O |
| InChI | InChI=1S/C41H62N4O15/c1-5-33(46)55-28-30-57-36(49)22-16-10-8-13-19-25-43-39(52)44(26-20-14-9-11-17-23-37(50)58-31-29-56-34(47)6-2)41(54)45(40(43)53)27-21-15-12-18-24-42-38(51)60-32(4)59-35(48)7-3/h5-7,32H,1-3,8-31H2,4H3,(H,42,51) |
| InChIKey | UAGYDZHFVVPZJY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 235.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|