C47H84N6O11 — CID 102023738
4-[6-[3,5-bis[6-(2-ethylhexoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]butyl prop-2-enoate (PubChem CID 102023738) has the molecular formula C47H84N6O11 and a molecular weight of 909.22 g/mol. Its IUPAC name is 4-[6-[3,5-bis[6-(2-ethylhexoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]butyl prop-2-enoate.
| Compound Name | 4-[6-[3,5-bis[6-(2-ethylhexoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 102023738 |
| Molecular Formula | C47H84N6O11 |
| Molecular Weight | 909.22 g/mol |
| Exact Mass | 908.62 |
| IUPAC Name | 4-[6-[3,5-bis[6-(2-ethylhexoxycarbonylamino)hexyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)NCCCCCCn1c(=O)n(CCCCCCNC(=O)OCC(CC)CCCC)c(=O)n(CCCCCCNC(=O)OCC(CC)CCCC)c1=O |
| InChI | InChI=1S/C47H84N6O11/c1-6-11-27-39(8-3)37-63-43(56)49-30-20-14-17-23-33-52-45(58)51(32-22-16-13-19-29-48-42(55)62-36-26-25-35-61-41(54)10-5)46(59)53(47(52)60)34-24-18-15-21-31-50-44(57)64-38-40(9-4)28-12-7-2/h10,39-40H,5-9,11-38H2,1-4H3,(H,48,55)(H,49,56)(H,50,57) |
| InChIKey | KEIJLMHNKBQOPI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 207.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.22 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|