C21H25N3O11 — CID 145340040
2-[2,4,6-trioxo-3,5-bis(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl 3-prop-2-enoyloxypropanoate (PubChem CID 145340040) has the molecular formula C21H25N3O11 and a molecular weight of 495.44 g/mol. Its IUPAC name is 2-[2,4,6-trioxo-3,5-bis(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl 3-prop-2-enoyloxypropanoate.
| Compound Name | 2-[2,4,6-trioxo-3,5-bis(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl 3-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 145340040 |
| Molecular Formula | C21H25N3O11 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl 3-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OCCC(=O)OCCn1c(=O)n(CCOC(=O)C=C)c(=O)n(CCOC(=O)C=C)c1=O |
| InChI | InChI=1S/C21H25N3O11/c1-4-15(25)32-11-7-18(28)35-14-10-24-20(30)22(8-12-33-16(26)5-2)19(29)23(21(24)31)9-13-34-17(27)6-3/h4-6H,1-3,7-14H2 |
| InChIKey | UAFSLSGYWRKMMX-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 171.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|