C18H21N3O9 — CID 123927081
2-[3-(3,4-dioxopentyl)-2,4,6-trioxo-5-(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate (PubChem CID 123927081) has the molecular formula C18H21N3O9 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-[3-(3,4-dioxopentyl)-2,4,6-trioxo-5-(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate.
| Compound Name | 2-[3-(3,4-dioxopentyl)-2,4,6-trioxo-5-(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 123927081 |
| Molecular Formula | C18H21N3O9 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[3-(3,4-dioxopentyl)-2,4,6-trioxo-5-(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCn1c(=O)n(CCOC(=O)C=C)c(=O)n(CCC(=O)C(C)=O)c1=O |
| InChI | InChI=1S/C18H21N3O9/c1-4-14(24)29-10-8-20-16(26)19(7-6-13(23)12(3)22)17(27)21(18(20)28)9-11-30-15(25)5-2/h4-5H,1-2,6-11H2,3H3 |
| InChIKey | PIEGWQAADRMKNQ-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|