C42H74N4O12 — CID 58225453
prop-2-enyl 2-(octoxycarbonylamino)-6-[4-[[5-(octoxycarbonylamino)-6-oxo-6-prop-2-enoxyhexyl]carbamoyloxy]butoxycarbonylamino]hexanoate (PubChem CID 58225453) has the molecular formula C42H74N4O12 and a molecular weight of 827.07 g/mol. Its IUPAC name is prop-2-enyl 2-(octoxycarbonylamino)-6-[4-[[5-(octoxycarbonylamino)-6-oxo-6-prop-2-enoxyhexyl]carbamoyloxy]butoxycarbonylamino]hexanoate.
| Compound Name | prop-2-enyl 2-(octoxycarbonylamino)-6-[4-[[5-(octoxycarbonylamino)-6-oxo-6-prop-2-enoxyhexyl]carbamoyloxy]butoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 58225453 |
| Molecular Formula | C42H74N4O12 |
| Molecular Weight | 827.07 g/mol |
| Exact Mass | 826.53 |
| IUPAC Name | prop-2-enyl 2-(octoxycarbonylamino)-6-[4-[[5-(octoxycarbonylamino)-6-oxo-6-prop-2-enoxyhexyl]carbamoyloxy]butoxycarbonylamino]hexanoate |
| SMILES | C=CCOC(=O)C(CCCCNC(=O)OCCCCOC(=O)NCCCCC(NC(=O)OCCCCCCCC)C(=O)OCC=C)NC(=O)OCCCCCCCC |
| InChI | InChI=1S/C42H74N4O12/c1-5-9-11-13-15-21-31-57-41(51)45-35(37(47)53-29-7-3)25-17-19-27-43-39(49)55-33-23-24-34-56-40(50)44-28-20-18-26-36(38(48)54-30-8-4)46-42(52)58-32-22-16-14-12-10-6-2/h7-8,35-36H,3-6,9-34H2,1-2H3,(H,43,49)(H,44,50)(H,45,51)(H,46,52) |
| InChIKey | AMIOZBFKOHNFMX-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 205.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.07 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|