C13H17N5O4 — CID 175456297
(2S)-6-amino-2-[(4-azidophenoxy)carbonylamino]hexanoic acid (PubChem CID 175456297) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is (2S)-6-amino-2-[(4-azidophenoxy)carbonylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(4-azidophenoxy)carbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175456297 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (2S)-6-amino-2-[(4-azidophenoxy)carbonylamino]hexanoic acid |
| SMILES | [N-]=[N+]=Nc1ccc(OC(=O)N[C@@H](CCCCN)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17N5O4/c14-8-2-1-3-11(12(19)20)16-13(21)22-10-6-4-9(5-7-10)17-18-15/h4-7,11H,1-3,8,14H2,(H,16,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | HMRZPOMMSONCKQ-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|