C15H32N4O2S — CID 18337282
6-amino-N-methyl-2-[[3-methylbutyl(2-sulfanylethyl)carbamoyl]amino]hexanamide (PubChem CID 18337282) has the molecular formula C15H32N4O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is 6-amino-N-methyl-2-[[3-methylbutyl(2-sulfanylethyl)carbamoyl]amino]hexanamide.
| Compound Name | 6-amino-N-methyl-2-[[3-methylbutyl(2-sulfanylethyl)carbamoyl]amino]hexanamide |
|---|---|
| PubChem CID | 18337282 |
| Molecular Formula | C15H32N4O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 6-amino-N-methyl-2-[[3-methylbutyl(2-sulfanylethyl)carbamoyl]amino]hexanamide |
| SMILES | CNC(=O)C(CCCCN)NC(=O)N(CCS)CCC(C)C |
| InChI | InChI=1S/C15H32N4O2S/c1-12(2)7-9-19(10-11-22)15(21)18-13(14(20)17-3)6-4-5-8-16/h12-13,22H,4-11,16H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | TXOCHWAYJQTKCS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|