C21H40N4O6 — CID 22879624
(2S)-2-[[[(2S)-2,5-dimethylhexanoyl]-hydroxycarbamoyl]amino]-N-methyl-N'-[(2-methylpropan-2-yl)oxy]heptanediamide (PubChem CID 22879624) has the molecular formula C21H40N4O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is (2S)-2-[[[(2S)-2,5-dimethylhexanoyl]-hydroxycarbamoyl]amino]-N-methyl-N'-[(2-methylpropan-2-yl)oxy]heptanediamide.
| Compound Name | (2S)-2-[[[(2S)-2,5-dimethylhexanoyl]-hydroxycarbamoyl]amino]-N-methyl-N'-[(2-methylpropan-2-yl)oxy]heptanediamide |
|---|---|
| PubChem CID | 22879624 |
| Molecular Formula | C21H40N4O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (2S)-2-[[[(2S)-2,5-dimethylhexanoyl]-hydroxycarbamoyl]amino]-N-methyl-N'-[(2-methylpropan-2-yl)oxy]heptanediamide |
| SMILES | CNC(=O)[C@H](CCCCC(=O)NOC(C)(C)C)NC(=O)N(O)C(=O)[C@@H](C)CCC(C)C |
| InChI | InChI=1S/C21H40N4O6/c1-14(2)12-13-15(3)19(28)25(30)20(29)23-16(18(27)22-7)10-8-9-11-17(26)24-31-21(4,5)6/h14-16,30H,8-13H2,1-7H3,(H,22,27)(H,23,29)(H,24,26)/t15-,16-/m0/s1 |
| InChIKey | QOGMKAQKPZIQQG-HOTGVXAUSA-N |
| XLogP | 2.51 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|