C18H35N3O5 — CID 22941550
(2S)-N-[[(2S)-1-(tert-butylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 22941550) has the molecular formula C18H35N3O5 and a molecular weight of 373.49 g/mol. Its IUPAC name is (2S)-N-[[(2S)-1-(tert-butylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S)-N-[[(2S)-1-(tert-butylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 22941550 |
| Molecular Formula | C18H35N3O5 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | (2S)-N-[[(2S)-1-(tert-butylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)CC[C@H](O)C(=O)N(O)C(=O)N[C@H](C(=O)NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H35N3O5/c1-11(2)9-10-12(22)15(24)21(26)16(25)19-13(17(3,4)5)14(23)20-18(6,7)8/h11-13,22,26H,9-10H2,1-8H3,(H,19,25)(H,20,23)/t12-,13+/m0/s1 |
| InChIKey | GTYYNNGZIKCMRH-QWHCGFSZSA-N |
| XLogP | 2.04 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|