C18H33N3O6S — CID 22861831
methyl (4S)-4-[[[(2S)-2-(ethylsulfanylmethyl)-5-methylhexanoyl]-hydroxycarbamoyl]amino]-5-(methylamino)-5-oxopentanoate (PubChem CID 22861831) has the molecular formula C18H33N3O6S and a molecular weight of 419.54 g/mol. Its IUPAC name is methyl (4S)-4-[[[(2S)-2-(ethylsulfanylmethyl)-5-methylhexanoyl]-hydroxycarbamoyl]amino]-5-(methylamino)-5-oxopentanoate.
| Compound Name | methyl (4S)-4-[[[(2S)-2-(ethylsulfanylmethyl)-5-methylhexanoyl]-hydroxycarbamoyl]amino]-5-(methylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 22861831 |
| Molecular Formula | C18H33N3O6S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | methyl (4S)-4-[[[(2S)-2-(ethylsulfanylmethyl)-5-methylhexanoyl]-hydroxycarbamoyl]amino]-5-(methylamino)-5-oxopentanoate |
| SMILES | CCSC[C@@H](CCC(C)C)C(=O)N(O)C(=O)N[C@@H](CCC(=O)OC)C(=O)NC |
| InChI | InChI=1S/C18H33N3O6S/c1-6-28-11-13(8-7-12(2)3)17(24)21(26)18(25)20-14(16(23)19-4)9-10-15(22)27-5/h12-14,26H,6-11H2,1-5H3,(H,19,23)(H,20,25)/t13-,14+/m1/s1 |
| InChIKey | HFBSBYIIFSTFFA-KGLIPLIRSA-N |
| XLogP | 1.79 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|