C12H22N2O5S — CID 107829145
(2R)-2-(1-ethylsulfanylpropan-2-ylcarbamoylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 107829145) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is (2R)-2-(1-ethylsulfanylpropan-2-ylcarbamoylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-(1-ethylsulfanylpropan-2-ylcarbamoylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829145 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (2R)-2-(1-ethylsulfanylpropan-2-ylcarbamoylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | CCSCC(C)NC(=O)N[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C12H22N2O5S/c1-4-20-7-8(2)13-12(18)14-9(11(16)17)5-6-10(15)19-3/h8-9H,4-7H2,1-3H3,(H,16,17)(H2,13,14,18)/t8?,9-/m1/s1 |
| InChIKey | AXUHGPGYXNFKMT-YGPZHTELSA-N |
| XLogP | 0.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |