C23H31ClFN5O6 — CID 145368921
6-amino-2-[[(4R)-5-amino-4-[[(2S)-2-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid (PubChem CID 145368921) has the molecular formula C23H31ClFN5O6 and a molecular weight of 527.98 g/mol. Its IUPAC name is 6-amino-2-[[(4R)-5-amino-4-[[(2S)-2-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[(4R)-5-amino-4-[[(2S)-2-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145368921 |
| Molecular Formula | C23H31ClFN5O6 |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 6-amino-2-[[(4R)-5-amino-4-[[(2S)-2-[[(E)-3-(2-chloro-4-fluorophenyl)prop-2-enoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
| SMILES | C[C@H](NC(=O)/C=C/c1ccc(F)cc1Cl)C(=O)N[C@H](CCC(=O)NC(CCCCN)C(=O)O)C(N)=O |
| InChI | InChI=1S/C23H31ClFN5O6/c1-13(28-19(31)9-6-14-5-7-15(25)12-16(14)24)22(34)30-17(21(27)33)8-10-20(32)29-18(23(35)36)4-2-3-11-26/h5-7,9,12-13,17-18H,2-4,8,10-11,26H2,1H3,(H2,27,33)(H,28,31)(H,29,32)(H,30,34)(H,35,36)/b9-6+/t13-,17+,18?/m0/s1 |
| InChIKey | HCDNSFVNEYQHQH-PBQNIHKRSA-N |
| XLogP | 0.45 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|