C26H36N6O9 — CID 154986987
(2S)-2-[[(4R)-5-amino-5-oxo-4-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propanoyl]amino]pentanoyl]amino]-6-(3-carboxypropanoylamino)hexanoic acid (PubChem CID 154986987) has the molecular formula C26H36N6O9 and a molecular weight of 576.61 g/mol. Its IUPAC name is (2S)-2-[[(4R)-5-amino-5-oxo-4-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propanoyl]amino]pentanoyl]amino]-6-(3-carboxypropanoylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(4R)-5-amino-5-oxo-4-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propanoyl]amino]pentanoyl]amino]-6-(3-carboxypropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 154986987 |
| Molecular Formula | C26H36N6O9 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | (2S)-2-[[(4R)-5-amino-5-oxo-4-[[(2S)-2-[[(E)-3-pyridin-2-ylprop-2-enoyl]amino]propanoyl]amino]pentanoyl]amino]-6-(3-carboxypropanoylamino)hexanoic acid |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccn1)C(=O)N[C@H](CCC(=O)N[C@@H](CCCCNC(=O)CCC(=O)O)C(=O)O)C(N)=O |
| InChI | InChI=1S/C26H36N6O9/c1-16(30-21(34)10-8-17-6-2-4-14-28-17)25(39)32-18(24(27)38)9-11-22(35)31-19(26(40)41)7-3-5-15-29-20(33)12-13-23(36)37/h2,4,6,8,10,14,16,18-19H,3,5,7,9,11-13,15H2,1H3,(H2,27,38)(H,29,33)(H,30,34)(H,31,35)(H,32,39)(H,36,37)(H,40,41)/b10-8+/t16-,18+,19-/m0/s1 |
| InChIKey | IXBLAZXBIXQJMH-PBRMNZKCSA-N |
| XLogP | -0.93 |
| TPSA | 246.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|