C34H54N6O11 — CID 130177301
2-[[1-carboxy-5-[[8-[6-[carboxymethyl(pyridin-2-ylmethyl)amino]hexan-2-ylamino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 130177301) has the molecular formula C34H54N6O11 and a molecular weight of 722.84 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[[8-[6-[carboxymethyl(pyridin-2-ylmethyl)amino]hexan-2-ylamino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[[8-[6-[carboxymethyl(pyridin-2-ylmethyl)amino]hexan-2-ylamino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130177301 |
| Molecular Formula | C34H54N6O11 |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 722.39 |
| IUPAC Name | 2-[[1-carboxy-5-[[8-[6-[carboxymethyl(pyridin-2-ylmethyl)amino]hexan-2-ylamino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(CCCCN(CC(=O)O)Cc1ccccn1)NC(=O)CCCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C34H54N6O11/c1-24(12-8-11-21-40(23-31(45)46)22-25-13-6-9-19-35-25)37-29(42)16-5-3-2-4-15-28(41)36-20-10-7-14-26(32(47)48)38-34(51)39-27(33(49)50)17-18-30(43)44/h6,9,13,19,24,26-27H,2-5,7-8,10-12,14-18,20-23H2,1H3,(H,36,41)(H,37,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H2,38,39,51) |
| InChIKey | JXZVADICIIFIME-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 264.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|