C24H31N5O6S — CID 135128759
(2S)-6-[bis(pyridin-2-ylmethyl)amino]-2-[[(1S)-1-carboxy-4-oxo-4-sulfanylbutyl]carbamoylamino]hexanoic acid (PubChem CID 135128759) has the molecular formula C24H31N5O6S and a molecular weight of 517.61 g/mol. Its IUPAC name is (2S)-6-[bis(pyridin-2-ylmethyl)amino]-2-[[(1S)-1-carboxy-4-oxo-4-sulfanylbutyl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-[bis(pyridin-2-ylmethyl)amino]-2-[[(1S)-1-carboxy-4-oxo-4-sulfanylbutyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 135128759 |
| Molecular Formula | C24H31N5O6S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (2S)-6-[bis(pyridin-2-ylmethyl)amino]-2-[[(1S)-1-carboxy-4-oxo-4-sulfanylbutyl]carbamoylamino]hexanoic acid |
| SMILES | O=C(S)CC[C@H](NC(=O)N[C@@H](CCCCN(Cc1ccccn1)Cc1ccccn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H31N5O6S/c30-21(36)11-10-20(23(33)34)28-24(35)27-19(22(31)32)9-3-6-14-29(15-17-7-1-4-12-25-17)16-18-8-2-5-13-26-18/h1-2,4-5,7-8,12-13,19-20H,3,6,9-11,14-16H2,(H,30,36)(H,31,32)(H,33,34)(H2,27,28,35)/t19-,20-/m0/s1 |
| InChIKey | NRSZWDUTZCXTFP-PMACEKPBSA-N |
| XLogP | 2.09 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|