C39H56N6O11 — CID 160533868
(2S)-2-[[(1S)-5-[[(10R)-14-[bis(pyridin-2-ylmethyl)amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 160533868) has the molecular formula C39H56N6O11 and a molecular weight of 784.91 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[(10R)-14-[bis(pyridin-2-ylmethyl)amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[(10R)-14-[bis(pyridin-2-ylmethyl)amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 160533868 |
| Molecular Formula | C39H56N6O11 |
| Molecular Weight | 784.91 g/mol |
| Exact Mass | 784.40 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[(10R)-14-[bis(pyridin-2-ylmethyl)amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CCCCCCC(=O)CC(CCCCN(Cc1ccccn1)Cc1ccccn1)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C39H56N6O11/c46-31(25-28(36(50)51)13-8-12-24-45(26-29-14-5-9-21-40-29)27-30-15-6-10-22-41-30)16-3-1-2-4-18-34(47)42-23-11-7-17-32(37(52)53)43-39(56)44-33(38(54)55)19-20-35(48)49/h5-6,9-10,14-15,21-22,28,32-33H,1-4,7-8,11-13,16-20,23-27H2,(H,42,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H2,43,44,56)/t28?,32-,33-/m0/s1 |
| InChIKey | QVXBQSKDLSPYDZ-GIAXFRNVSA-N |
| XLogP | 4.01 |
| TPSA | 265.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|