C28H38N6O9 — CID 140660047
(2S)-2-[[(1S)-5-[3-[[bis(pyridin-2-ylmethyl)amino]methoxy]propanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 140660047) has the molecular formula C28H38N6O9 and a molecular weight of 602.65 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[3-[[bis(pyridin-2-ylmethyl)amino]methoxy]propanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[3-[[bis(pyridin-2-ylmethyl)amino]methoxy]propanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 140660047 |
| Molecular Formula | C28H38N6O9 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | (2S)-2-[[(1S)-5-[3-[[bis(pyridin-2-ylmethyl)amino]methoxy]propanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CCOCN(Cc1ccccn1)Cc1ccccn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C28H38N6O9/c35-24(12-16-43-19-34(17-20-7-1-4-13-29-20)18-21-8-2-5-14-30-21)31-15-6-3-9-22(26(38)39)32-28(42)33-23(27(40)41)10-11-25(36)37/h1-2,4-5,7-8,13-14,22-23H,3,6,9-12,15-19H2,(H,31,35)(H,36,37)(H,38,39)(H,40,41)(H2,32,33,42)/t22-,23-/m0/s1 |
| InChIKey | SLMHHYMMGFEDBH-GOTSBHOMSA-N |
| XLogP | 1.20 |
| TPSA | 220.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|