C33H57N5O5 — CID 158273083
2-[[14-[6-[methyl(pyridin-2-ylmethyl)amino]hexylamino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid (PubChem CID 158273083) has the molecular formula C33H57N5O5 and a molecular weight of 603.85 g/mol. Its IUPAC name is 2-[[14-[6-[methyl(pyridin-2-ylmethyl)amino]hexylamino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid.
| Compound Name | 2-[[14-[6-[methyl(pyridin-2-ylmethyl)amino]hexylamino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 158273083 |
| Molecular Formula | C33H57N5O5 |
| Molecular Weight | 603.85 g/mol |
| Exact Mass | 603.44 |
| IUPAC Name | 2-[[14-[6-[methyl(pyridin-2-ylmethyl)amino]hexylamino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)NCCCCCCC(=O)CCCCCCC(=O)NCCCCCCN(C)Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C33H57N5O5/c1-3-18-30(32(41)42)37-33(43)36-25-15-7-6-11-21-29(39)20-10-4-5-12-22-31(40)35-24-14-8-9-17-26-38(2)27-28-19-13-16-23-34-28/h13,16,19,23,30H,3-12,14-15,17-18,20-22,24-27H2,1-2H3,(H,35,40)(H,41,42)(H2,36,37,43) |
| InChIKey | YBHFUDCSODOQIS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|