C33H55N5O7 — CID 160870573
2-[[14-[[1-formyloxy-5-[methyl(pyridin-2-ylmethyl)amino]pentyl]amino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid (PubChem CID 160870573) has the molecular formula C33H55N5O7 and a molecular weight of 633.83 g/mol. Its IUPAC name is 2-[[14-[[1-formyloxy-5-[methyl(pyridin-2-ylmethyl)amino]pentyl]amino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid.
| Compound Name | 2-[[14-[[1-formyloxy-5-[methyl(pyridin-2-ylmethyl)amino]pentyl]amino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 160870573 |
| Molecular Formula | C33H55N5O7 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.41 |
| IUPAC Name | 2-[[14-[[1-formyloxy-5-[methyl(pyridin-2-ylmethyl)amino]pentyl]amino]-7,14-dioxotetradecyl]carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)NCCCCCCC(=O)CCCCCCC(=O)NC(CCCCN(C)Cc1ccccn1)OC=O)C(=O)O |
| InChI | InChI=1S/C33H55N5O7/c1-3-16-29(32(42)43)36-33(44)35-23-13-7-6-9-19-28(40)18-8-4-5-10-20-30(41)37-31(45-26-39)21-12-15-24-38(2)25-27-17-11-14-22-34-27/h11,14,17,22,26,29,31H,3-10,12-13,15-16,18-21,23-25H2,1-2H3,(H,37,41)(H,42,43)(H2,35,36,44) |
| InChIKey | SGPSATYTQOYRPM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 167.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|