C34H57FN6O8 — CID 159237240
(2S)-2-[[(1R)-5-[[18-[1-(2-(18F)fluoroethyl)triazol-4-yl]-8,16-dioxooctadecanoyl]amino]-1-formyloxypentyl]carbamoylamino]pentanoic acid (PubChem CID 159237240) has the molecular formula C34H57FN6O8 and a molecular weight of 695.86 g/mol. Its IUPAC name is (2S)-2-[[(1R)-5-[[18-[1-(2-(18F)fluoroethyl)triazol-4-yl]-8,16-dioxooctadecanoyl]amino]-1-formyloxypentyl]carbamoylamino]pentanoic acid.
| Compound Name | (2S)-2-[[(1R)-5-[[18-[1-(2-(18F)fluoroethyl)triazol-4-yl]-8,16-dioxooctadecanoyl]amino]-1-formyloxypentyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 159237240 |
| Molecular Formula | C34H57FN6O8 |
| Molecular Weight | 695.86 g/mol |
| Exact Mass | 695.42 |
| IUPAC Name | (2S)-2-[[(1R)-5-[[18-[1-(2-(18F)fluoroethyl)triazol-4-yl]-8,16-dioxooctadecanoyl]amino]-1-formyloxypentyl]carbamoylamino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CCCCCCC(=O)CCCCCCCC(=O)CCc1cn(CC[18F])nn1)OC=O)C(=O)O |
| InChI | InChI=1S/C34H57FN6O8/c1-2-14-30(33(46)47)37-34(48)38-32(49-26-42)19-12-13-23-36-31(45)18-11-7-6-10-16-28(43)15-8-4-3-5-9-17-29(44)21-20-27-25-41(24-22-35)40-39-27/h25-26,30,32H,2-24H2,1H3,(H,36,45)(H,46,47)(H2,37,38,48)/t30-,32+/m0/s1/i35-1 |
| InChIKey | JQLRCJNUJXFDIR-YHKIUQCRSA-N |
| XLogP | 4.73 |
| TPSA | 198.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|