C12H23N3O5 — CID 135242549
2-[(5-amino-1-formyloxypentyl)carbamoylamino]pentanoic acid (PubChem CID 135242549) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[(5-amino-1-formyloxypentyl)carbamoylamino]pentanoic acid.
| Compound Name | 2-[(5-amino-1-formyloxypentyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 135242549 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[(5-amino-1-formyloxypentyl)carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)NC(CCCCN)OC=O)C(=O)O |
| InChI | InChI=1S/C12H23N3O5/c1-2-5-9(11(17)18)14-12(19)15-10(20-8-16)6-3-4-7-13/h8-10H,2-7,13H2,1H3,(H,17,18)(H2,14,15,19) |
| InChIKey | PATDWQAINJVXTG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|