C11H18N6O5 — CID 90352267
(2S)-2-[[(1R)-1-formyloxy-3-(2H-tetrazol-5-yl)propyl]carbamoylamino]pentanoic acid (PubChem CID 90352267) has the molecular formula C11H18N6O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is (2S)-2-[[(1R)-1-formyloxy-3-(2H-tetrazol-5-yl)propyl]carbamoylamino]pentanoic acid.
| Compound Name | (2S)-2-[[(1R)-1-formyloxy-3-(2H-tetrazol-5-yl)propyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 90352267 |
| Molecular Formula | C11H18N6O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2S)-2-[[(1R)-1-formyloxy-3-(2H-tetrazol-5-yl)propyl]carbamoylamino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)N[C@@H](CCc1nn[nH]n1)OC=O)C(=O)O |
| InChI | InChI=1S/C11H18N6O5/c1-2-3-7(10(19)20)12-11(21)13-9(22-6-18)5-4-8-14-16-17-15-8/h6-7,9H,2-5H2,1H3,(H,19,20)(H2,12,13,21)(H,14,15,16,17)/t7-,9+/m0/s1 |
| InChIKey | WPLZCSHRCXNJDR-IONNQARKSA-N |
| XLogP | -0.82 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|