C14H20FN5O7 — CID 153411113
(2S)-2-[[(1R)-3-[4-(2-(18F)fluoroethyl)triazol-1-yl]-1-formyloxypropyl]carbamoylamino]pentanedioic acid (PubChem CID 153411113) has the molecular formula C14H20FN5O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is (2S)-2-[[(1R)-3-[4-(2-(18F)fluoroethyl)triazol-1-yl]-1-formyloxypropyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1R)-3-[4-(2-(18F)fluoroethyl)triazol-1-yl]-1-formyloxypropyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 153411113 |
| Molecular Formula | C14H20FN5O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2S)-2-[[(1R)-3-[4-(2-(18F)fluoroethyl)triazol-1-yl]-1-formyloxypropyl]carbamoylamino]pentanedioic acid |
| SMILES | O=CO[C@H](CCn1cc(CC[18F])nn1)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H20FN5O7/c15-5-3-9-7-20(19-18-9)6-4-11(27-8-21)17-14(26)16-10(13(24)25)1-2-12(22)23/h7-8,10-11H,1-6H2,(H,22,23)(H,24,25)(H2,16,17,26)/t10-,11+/m0/s1/i15-1 |
| InChIKey | KJHNQOKDTOGMMT-YTJLTQHMSA-N |
| XLogP | -0.70 |
| TPSA | 172.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|