C26H35FN6O8 — CID 71275649
(2S)-2-[[(1S)-1-carboxy-2-[4-[6-[4-(3-fluoropropyl)triazol-1-yl]hexanoylamino]phenyl]ethyl]carbamoylamino]pentanedioic acid (PubChem CID 71275649) has the molecular formula C26H35FN6O8 and a molecular weight of 578.60 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-2-[4-[6-[4-(3-fluoropropyl)triazol-1-yl]hexanoylamino]phenyl]ethyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-2-[4-[6-[4-(3-fluoropropyl)triazol-1-yl]hexanoylamino]phenyl]ethyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 71275649 |
| Molecular Formula | C26H35FN6O8 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-2-[4-[6-[4-(3-fluoropropyl)triazol-1-yl]hexanoylamino]phenyl]ethyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](Cc1ccc(NC(=O)CCCCCn2cc(CCCF)nn2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H35FN6O8/c27-13-4-5-19-16-33(32-31-19)14-3-1-2-6-22(34)28-18-9-7-17(8-10-18)15-21(25(39)40)30-26(41)29-20(24(37)38)11-12-23(35)36/h7-10,16,20-21H,1-6,11-15H2,(H,28,34)(H,35,36)(H,37,38)(H,39,40)(H2,29,30,41)/t20-,21-/m0/s1 |
| InChIKey | ADQFXTLASYCHFR-SFTDATJTSA-N |
| XLogP | 1.99 |
| TPSA | 212.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|