C26H36FN5O11 — CID 144538711
(2S)-2-[[(1S)-1-carboxy-2-[4-[2-[2-[2-[4-(3-fluoropropyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]phenyl]ethoxy]carbamoylamino]pentanedioic acid (PubChem CID 144538711) has the molecular formula C26H36FN5O11 and a molecular weight of 613.60 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-2-[4-[2-[2-[2-[4-(3-fluoropropyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]phenyl]ethoxy]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-2-[4-[2-[2-[2-[4-(3-fluoropropyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]phenyl]ethoxy]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 144538711 |
| Molecular Formula | C26H36FN5O11 |
| Molecular Weight | 613.60 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-2-[4-[2-[2-[2-[4-(3-fluoropropyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]phenyl]ethoxy]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NO[C@@H](Cc1ccc(OCCOCCOCCn2cc(CCCF)nn2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H36FN5O11/c27-9-1-2-19-17-32(31-29-19)10-11-40-12-13-41-14-15-42-20-5-3-18(4-6-20)16-22(25(37)38)43-30-26(39)28-21(24(35)36)7-8-23(33)34/h3-6,17,21-22H,1-2,7-16H2,(H,33,34)(H,35,36)(H,37,38)(H2,28,30,39)/t21-,22-/m0/s1 |
| InChIKey | KOBDXGKPPMOBKC-VXKWHMMOSA-N |
| XLogP | 0.84 |
| TPSA | 220.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.60 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|