C38H59N9O14 — CID 144721884
2-[[5-[4-[6-[[4-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]hexyl]triazol-1-yl]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 144721884) has the molecular formula C38H59N9O14 and a molecular weight of 865.94 g/mol. Its IUPAC name is 2-[[5-[4-[6-[[4-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]hexyl]triazol-1-yl]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[5-[4-[6-[[4-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]hexyl]triazol-1-yl]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 144721884 |
| Molecular Formula | C38H59N9O14 |
| Molecular Weight | 865.94 g/mol |
| Exact Mass | 865.42 |
| IUPAC Name | 2-[[5-[4-[6-[[4-[2-[2-[2-[2-[(2-aminooxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethylcarbamoyl]benzoyl]amino]hexyl]triazol-1-yl]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | NOCC(=O)NCCOCCOCCOCCNC(=O)c1ccc(C(=O)NCCCCCCc2cn(CCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)nn2)cc1 |
| InChI | InChI=1S/C38H59N9O14/c39-61-26-32(48)40-16-19-58-21-23-60-24-22-59-20-17-42-35(52)28-11-9-27(10-12-28)34(51)41-15-5-2-1-3-7-29-25-47(46-45-29)18-6-4-8-30(36(53)54)43-38(57)44-31(37(55)56)13-14-33(49)50/h9-12,25,30-31H,1-8,13-24,26,39H2,(H,40,48)(H,41,51)(H,42,52)(H,49,50)(H,53,54)(H,55,56)(H2,43,44,57) |
| InChIKey | BSDJPXVLUIDPAY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 333.98 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.94 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|