C16H25N5O7 — CID 170047972
(2R)-2-[[(1S)-1-carboxy-5-(4-ethyltriazol-1-yl)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 170047972) has the molecular formula C16H25N5O7 and a molecular weight of 399.40 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-carboxy-5-(4-ethyltriazol-1-yl)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2R)-2-[[(1S)-1-carboxy-5-(4-ethyltriazol-1-yl)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 170047972 |
| Molecular Formula | C16H25N5O7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2R)-2-[[(1S)-1-carboxy-5-(4-ethyltriazol-1-yl)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CCc1cn(CCCC[C@H](NC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O)nn1 |
| InChI | InChI=1S/C16H25N5O7/c1-2-10-9-21(20-19-10)8-4-3-5-11(14(24)25)17-16(28)18-12(15(26)27)6-7-13(22)23/h9,11-12H,2-8H2,1H3,(H,22,23)(H,24,25)(H,26,27)(H2,17,18,28)/t11-,12+/m0/s1 |
| InChIKey | GKIWCYKXINEBSJ-NWDGAFQWSA-N |
| XLogP | 0.08 |
| TPSA | 183.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|